About 4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]phenol
4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]phenol (PubChem CID 10614402) has the molecular formula C21H21NO
and a molecular weight of 303.41 g/mol. Its IUPAC name is 4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]phenol.
Molecular Properties
| Compound Name | 4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]phenol |
| PubChem CID | 10614402 |
| Molecular Formula | C21H21NO |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]phenol |
| SMILES | Oc1ccc(C#CCCN2CC=C(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H21NO/c23-21-11-9-18(10-12-21)6-4-5-15-22-16-13-20(14-17-22)19-7-2-1-3-8-19/h1-3,7-13,23H,5,14-17H2 |
| InChIKey | JLZXBPBMBUIBQC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]phenol?
The IUPAC name of 4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]phenol (CID 10614402) is 4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]phenol.
What is the SMILES notation for 4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]phenol?
The canonical SMILES for 4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]phenol is Oc1ccc(C#CCCN2CC=C(c3ccccc3)CC2)cc1.
What is the InChIKey of 4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]phenol?
The InChIKey is JLZXBPBMBUIBQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO/c23-21-11-9-18(10-12-21)6-4-5-15-22-16-13-20(14-17-22)19-7-2-1-3-8-19/h1-3,7-13,23H,5,14-17H2.
What are the key properties of 4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]phenol?
4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]phenol has a molecular weight of 303.41 g/mol, XLogP of 3.92, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]phenol is sourced from PubChem (CID 10614402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).