About 5-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-4,4-dimethylpentan-1-ol
5-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-4,4-dimethylpentan-1-ol (PubChem CID 106144196) has the molecular formula C14H21BrN4O
and a molecular weight of 341.25 g/mol. Its IUPAC name is 5-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-4,4-dimethylpentan-1-ol.
Molecular Properties
| Compound Name | 5-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-4,4-dimethylpentan-1-ol |
| PubChem CID | 106144196 |
| Molecular Formula | C14H21BrN4O |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 5-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(CCCO)CNCc1cnc2cnc(Br)cn12 |
| InChI | InChI=1S/C14H21BrN4O/c1-14(2,4-3-5-20)10-16-6-11-7-18-13-8-17-12(15)9-19(11)13/h7-9,16,20H,3-6,10H2,1-2H3 |
| InChIKey | NHQIEXCEVVUXIG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-4,4-dimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-4,4-dimethylpentan-1-ol?
The IUPAC name of 5-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-4,4-dimethylpentan-1-ol (CID 106144196) is 5-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-4,4-dimethylpentan-1-ol.
What is the SMILES notation for 5-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-4,4-dimethylpentan-1-ol?
The canonical SMILES for 5-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-4,4-dimethylpentan-1-ol is CC(C)(CCCO)CNCc1cnc2cnc(Br)cn12.
What is the InChIKey of 5-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-4,4-dimethylpentan-1-ol?
The InChIKey is NHQIEXCEVVUXIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21BrN4O/c1-14(2,4-3-5-20)10-16-6-11-7-18-13-8-17-12(15)9-19(11)13/h7-9,16,20H,3-6,10H2,1-2H3.
What are the key properties of 5-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-4,4-dimethylpentan-1-ol?
5-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-4,4-dimethylpentan-1-ol has a molecular weight of 341.25 g/mol, XLogP of 2.38, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]-4,4-dimethylpentan-1-ol is sourced from PubChem (CID 106144196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).