C13H24ClNOS — CID 106144248
N-(5-chloro-2,2-dimethylpentyl)-2-methylthiolane-2-carboxamide (PubChem CID 106144248) has the molecular formula C13H24ClNOS and a molecular weight of 277.86 g/mol. Its IUPAC name is N-(5-chloro-2,2-dimethylpentyl)-2-methylthiolane-2-carboxamide.
| Compound Name | N-(5-chloro-2,2-dimethylpentyl)-2-methylthiolane-2-carboxamide |
|---|---|
| PubChem CID | 106144248 |
| Molecular Formula | C13H24ClNOS |
| Molecular Weight | 277.86 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-(5-chloro-2,2-dimethylpentyl)-2-methylthiolane-2-carboxamide |
| SMILES | CC(C)(CCCCl)CNC(=O)C1(C)CCCS1 |
| InChI | InChI=1S/C13H24ClNOS/c1-12(2,6-4-8-14)10-15-11(16)13(3)7-5-9-17-13/h4-10H2,1-3H3,(H,15,16) |
| InChIKey | UNDTWMYBKFBZFP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.86 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|