C13H23N3O — CID 106144540
3,3-dimethyl-4-[(6-propylpyrimidin-4-yl)amino]butan-1-ol (PubChem CID 106144540) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 3,3-dimethyl-4-[(6-propylpyrimidin-4-yl)amino]butan-1-ol.
| Compound Name | 3,3-dimethyl-4-[(6-propylpyrimidin-4-yl)amino]butan-1-ol |
|---|---|
| PubChem CID | 106144540 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 3,3-dimethyl-4-[(6-propylpyrimidin-4-yl)amino]butan-1-ol |
| SMILES | CCCc1cc(NCC(C)(C)CCO)ncn1 |
| InChI | InChI=1S/C13H23N3O/c1-4-5-11-8-12(16-10-15-11)14-9-13(2,3)6-7-17/h8,10,17H,4-7,9H2,1-3H3,(H,14,15,16) |
| InChIKey | FCRZWSHJMUMCHI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |