About 5-(3,4-dihydro-1H-isochromen-4-ylamino)-4,4-dimethylpentan-1-ol
5-(3,4-dihydro-1H-isochromen-4-ylamino)-4,4-dimethylpentan-1-ol (PubChem CID 106144670) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is 5-(3,4-dihydro-1H-isochromen-4-ylamino)-4,4-dimethylpentan-1-ol.
Molecular Properties
| Compound Name | 5-(3,4-dihydro-1H-isochromen-4-ylamino)-4,4-dimethylpentan-1-ol |
| PubChem CID | 106144670 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 5-(3,4-dihydro-1H-isochromen-4-ylamino)-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(CCCO)CNC1COCc2ccccc21 |
| InChI | InChI=1S/C16H25NO2/c1-16(2,8-5-9-18)12-17-15-11-19-10-13-6-3-4-7-14(13)15/h3-4,6-7,15,17-18H,5,8-12H2,1-2H3 |
| InChIKey | ZHGFRUSZCBOOTP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3,4-dihydro-1H-isochromen-4-ylamino)-4,4-dimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dihydro-1H-isochromen-4-ylamino)-4,4-dimethylpentan-1-ol?
The IUPAC name of 5-(3,4-dihydro-1H-isochromen-4-ylamino)-4,4-dimethylpentan-1-ol (CID 106144670) is 5-(3,4-dihydro-1H-isochromen-4-ylamino)-4,4-dimethylpentan-1-ol.
What is the SMILES notation for 5-(3,4-dihydro-1H-isochromen-4-ylamino)-4,4-dimethylpentan-1-ol?
The canonical SMILES for 5-(3,4-dihydro-1H-isochromen-4-ylamino)-4,4-dimethylpentan-1-ol is CC(C)(CCCO)CNC1COCc2ccccc21.
What is the InChIKey of 5-(3,4-dihydro-1H-isochromen-4-ylamino)-4,4-dimethylpentan-1-ol?
The InChIKey is ZHGFRUSZCBOOTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c1-16(2,8-5-9-18)12-17-15-11-19-10-13-6-3-4-7-14(13)15/h3-4,6-7,15,17-18H,5,8-12H2,1-2H3.
What are the key properties of 5-(3,4-dihydro-1H-isochromen-4-ylamino)-4,4-dimethylpentan-1-ol?
5-(3,4-dihydro-1H-isochromen-4-ylamino)-4,4-dimethylpentan-1-ol has a molecular weight of 263.38 g/mol, XLogP of 2.65, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dihydro-1H-isochromen-4-ylamino)-4,4-dimethylpentan-1-ol is sourced from PubChem (CID 106144670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).