C11H19ClF3NO — CID 106144775
N-(5-chloro-2,2-dimethylpentyl)-4,4,4-trifluorobutanamide (PubChem CID 106144775) has the molecular formula C11H19ClF3NO and a molecular weight of 273.73 g/mol. Its IUPAC name is N-(5-chloro-2,2-dimethylpentyl)-4,4,4-trifluorobutanamide.
| Compound Name | N-(5-chloro-2,2-dimethylpentyl)-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 106144775 |
| Molecular Formula | C11H19ClF3NO |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-(5-chloro-2,2-dimethylpentyl)-4,4,4-trifluorobutanamide |
| SMILES | CC(C)(CCCCl)CNC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C11H19ClF3NO/c1-10(2,5-3-7-12)8-16-9(17)4-6-11(13,14)15/h3-8H2,1-2H3,(H,16,17) |
| InChIKey | GSOBFRNSMFOMEC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|