C16H32O5 — CID 10614480
(3R,4R,5R,6R,9S)-9-methoxy-5-(methoxymethoxy)-4,6-dimethylundec-10-ene-1,3-diol (PubChem CID 10614480) has the molecular formula C16H32O5 and a molecular weight of 304.43 g/mol. Its IUPAC name is (3R,4R,5R,6R,9S)-9-methoxy-5-(methoxymethoxy)-4,6-dimethylundec-10-ene-1,3-diol.
| Compound Name | (3R,4R,5R,6R,9S)-9-methoxy-5-(methoxymethoxy)-4,6-dimethylundec-10-ene-1,3-diol |
|---|---|
| PubChem CID | 10614480 |
| Molecular Formula | C16H32O5 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (3R,4R,5R,6R,9S)-9-methoxy-5-(methoxymethoxy)-4,6-dimethylundec-10-ene-1,3-diol |
| SMILES | C=C[C@H](CC[C@@H](C)[C@@H](OCOC)[C@H](C)[C@H](O)CCO)OC |
| InChI | InChI=1S/C16H32O5/c1-6-14(20-5)8-7-12(2)16(21-11-19-4)13(3)15(18)9-10-17/h6,12-18H,1,7-11H2,2-5H3/t12-,13-,14-,15-,16-/m1/s1 |
| InChIKey | ZFASEVSQCHTLOX-OXGONZEZSA-N |
| XLogP | 1.97 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|