About 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-4,4-dimethylpentan-1-ol
5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-4,4-dimethylpentan-1-ol (PubChem CID 106144802) has the molecular formula C16H31NO
and a molecular weight of 253.43 g/mol. Its IUPAC name is 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-4,4-dimethylpentan-1-ol.
Molecular Properties
| Compound Name | 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-4,4-dimethylpentan-1-ol |
| PubChem CID | 106144802 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-4,4-dimethylpentan-1-ol |
| SMILES | CC1=CC(C)CC(CNCC(C)(C)CCCO)C1 |
| InChI | InChI=1S/C16H31NO/c1-13-8-14(2)10-15(9-13)11-17-12-16(3,4)6-5-7-18/h8,13,15,17-18H,5-7,9-12H2,1-4H3 |
| InChIKey | KVQRMVYFPSGNFM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-4,4-dimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-4,4-dimethylpentan-1-ol?
The IUPAC name of 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-4,4-dimethylpentan-1-ol (CID 106144802) is 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-4,4-dimethylpentan-1-ol.
What is the SMILES notation for 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-4,4-dimethylpentan-1-ol?
The canonical SMILES for 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-4,4-dimethylpentan-1-ol is CC1=CC(C)CC(CNCC(C)(C)CCCO)C1.
What is the InChIKey of 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-4,4-dimethylpentan-1-ol?
The InChIKey is KVQRMVYFPSGNFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO/c1-13-8-14(2)10-15(9-13)11-17-12-16(3,4)6-5-7-18/h8,13,15,17-18H,5-7,9-12H2,1-4H3.
What are the key properties of 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-4,4-dimethylpentan-1-ol?
5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-4,4-dimethylpentan-1-ol has a molecular weight of 253.43 g/mol, XLogP of 3.37, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]-4,4-dimethylpentan-1-ol is sourced from PubChem (CID 106144802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).