C16H25N3O — CID 106145375
1-(dimethylamino)-2-methyl-3-[(1-methylindol-3-yl)methylamino]propan-2-ol (PubChem CID 106145375) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 1-(dimethylamino)-2-methyl-3-[(1-methylindol-3-yl)methylamino]propan-2-ol.
| Compound Name | 1-(dimethylamino)-2-methyl-3-[(1-methylindol-3-yl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 106145375 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 1-(dimethylamino)-2-methyl-3-[(1-methylindol-3-yl)methylamino]propan-2-ol |
| SMILES | CN(C)CC(C)(O)CNCc1cn(C)c2ccccc12 |
| InChI | InChI=1S/C16H25N3O/c1-16(20,12-18(2)3)11-17-9-13-10-19(4)15-8-6-5-7-14(13)15/h5-8,10,17,20H,9,11-12H2,1-4H3 |
| InChIKey | RLNBPTOESMWMOG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 40.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |