C18H27NO3 — CID 10614542
(3aR,4S,7S,7aS)-4-[(1S,2R)-2-(methoxymethyl)cyclohexyl]-2,7-dimethyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 10614542) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is (3aR,4S,7S,7aS)-4-[(1S,2R)-2-(methoxymethyl)cyclohexyl]-2,7-dimethyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,4S,7S,7aS)-4-[(1S,2R)-2-(methoxymethyl)cyclohexyl]-2,7-dimethyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 10614542 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (3aR,4S,7S,7aS)-4-[(1S,2R)-2-(methoxymethyl)cyclohexyl]-2,7-dimethyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | COC[C@@H]1CCCC[C@H]1[C@@H]1C=C[C@H](C)[C@@H]2C(=O)N(C)C(=O)[C@H]12 |
| InChI | InChI=1S/C18H27NO3/c1-11-8-9-14(13-7-5-4-6-12(13)10-22-3)16-15(11)17(20)19(2)18(16)21/h8-9,11-16H,4-7,10H2,1-3H3/t11-,12-,13+,14-,15-,16+/m0/s1 |
| InChIKey | DSBZDIAUJIKXFU-KXKVQDCLSA-N |
| XLogP | 2.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|