About N-(4-bromo-2,2-dimethylbutyl)-1,1-difluoromethanesulfonamide
N-(4-bromo-2,2-dimethylbutyl)-1,1-difluoromethanesulfonamide (PubChem CID 106145803) has the molecular formula C7H14BrF2NO2S
and a molecular weight of 294.16 g/mol. Its IUPAC name is N-(4-bromo-2,2-dimethylbutyl)-1,1-difluoromethanesulfonamide.
Molecular Properties
| Compound Name | N-(4-bromo-2,2-dimethylbutyl)-1,1-difluoromethanesulfonamide |
| PubChem CID | 106145803 |
| Molecular Formula | C7H14BrF2NO2S |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | N-(4-bromo-2,2-dimethylbutyl)-1,1-difluoromethanesulfonamide |
| SMILES | CC(C)(CCBr)CNS(=O)(=O)C(F)F |
| InChI | InChI=1S/C7H14BrF2NO2S/c1-7(2,3-4-8)5-11-14(12,13)6(9)10/h6,11H,3-5H2,1-2H3 |
| InChIKey | WUOSMSFWMSOTIH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromo-2,2-dimethylbutyl)-1,1-difluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-2,2-dimethylbutyl)-1,1-difluoromethanesulfonamide?
The IUPAC name of N-(4-bromo-2,2-dimethylbutyl)-1,1-difluoromethanesulfonamide (CID 106145803) is N-(4-bromo-2,2-dimethylbutyl)-1,1-difluoromethanesulfonamide.
What is the SMILES notation for N-(4-bromo-2,2-dimethylbutyl)-1,1-difluoromethanesulfonamide?
The canonical SMILES for N-(4-bromo-2,2-dimethylbutyl)-1,1-difluoromethanesulfonamide is CC(C)(CCBr)CNS(=O)(=O)C(F)F.
What is the InChIKey of N-(4-bromo-2,2-dimethylbutyl)-1,1-difluoromethanesulfonamide?
The InChIKey is WUOSMSFWMSOTIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14BrF2NO2S/c1-7(2,3-4-8)5-11-14(12,13)6(9)10/h6,11H,3-5H2,1-2H3.
What are the key properties of N-(4-bromo-2,2-dimethylbutyl)-1,1-difluoromethanesulfonamide?
N-(4-bromo-2,2-dimethylbutyl)-1,1-difluoromethanesulfonamide has a molecular weight of 294.16 g/mol, XLogP of 1.94, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-2,2-dimethylbutyl)-1,1-difluoromethanesulfonamide is sourced from PubChem (CID 106145803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).