About 5-(1,1-dioxothiazinan-2-yl)-4,4-dimethylpentan-1-ol
5-(1,1-dioxothiazinan-2-yl)-4,4-dimethylpentan-1-ol (PubChem CID 106146109) has the molecular formula C11H23NO3S
and a molecular weight of 249.38 g/mol. Its IUPAC name is 5-(1,1-dioxothiazinan-2-yl)-4,4-dimethylpentan-1-ol.
Molecular Properties
| Compound Name | 5-(1,1-dioxothiazinan-2-yl)-4,4-dimethylpentan-1-ol |
| PubChem CID | 106146109 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 5-(1,1-dioxothiazinan-2-yl)-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(CCCO)CN1CCCCS1(=O)=O |
| InChI | InChI=1S/C11H23NO3S/c1-11(2,6-5-8-13)10-12-7-3-4-9-16(12,14)15/h13H,3-10H2,1-2H3 |
| InChIKey | JDRXZOASKQJBOV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(1,1-dioxothiazinan-2-yl)-4,4-dimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,1-dioxothiazinan-2-yl)-4,4-dimethylpentan-1-ol?
The IUPAC name of 5-(1,1-dioxothiazinan-2-yl)-4,4-dimethylpentan-1-ol (CID 106146109) is 5-(1,1-dioxothiazinan-2-yl)-4,4-dimethylpentan-1-ol.
What is the SMILES notation for 5-(1,1-dioxothiazinan-2-yl)-4,4-dimethylpentan-1-ol?
The canonical SMILES for 5-(1,1-dioxothiazinan-2-yl)-4,4-dimethylpentan-1-ol is CC(C)(CCCO)CN1CCCCS1(=O)=O.
What is the InChIKey of 5-(1,1-dioxothiazinan-2-yl)-4,4-dimethylpentan-1-ol?
The InChIKey is JDRXZOASKQJBOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO3S/c1-11(2,6-5-8-13)10-12-7-3-4-9-16(12,14)15/h13H,3-10H2,1-2H3.
What are the key properties of 5-(1,1-dioxothiazinan-2-yl)-4,4-dimethylpentan-1-ol?
5-(1,1-dioxothiazinan-2-yl)-4,4-dimethylpentan-1-ol has a molecular weight of 249.38 g/mol, XLogP of 1.21, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,1-dioxothiazinan-2-yl)-4,4-dimethylpentan-1-ol is sourced from PubChem (CID 106146109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).