C15H23NO3 — CID 106146189
(3aS,7aR)-2-(5-hydroxy-2,2-dimethylpentyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 106146189) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is (3aS,7aR)-2-(5-hydroxy-2,2-dimethylpentyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aR)-2-(5-hydroxy-2,2-dimethylpentyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 106146189 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | (3aS,7aR)-2-(5-hydroxy-2,2-dimethylpentyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC(C)(CCCO)CN1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C15H23NO3/c1-15(2,8-5-9-17)10-16-13(18)11-6-3-4-7-12(11)14(16)19/h3-4,11-12,17H,5-10H2,1-2H3/t11-,12+ |
| InChIKey | YIWQKKLDNIRWNW-TXEJJXNPSA-N |
| XLogP | 1.74 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|