C14H18N2O3 — CID 106146222
2-(5-hydroxy-2,2-dimethylpentyl)pyrrolo[3,4-c]pyridine-1,3-dione (PubChem CID 106146222) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-(5-hydroxy-2,2-dimethylpentyl)pyrrolo[3,4-c]pyridine-1,3-dione.
| Compound Name | 2-(5-hydroxy-2,2-dimethylpentyl)pyrrolo[3,4-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 106146222 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-(5-hydroxy-2,2-dimethylpentyl)pyrrolo[3,4-c]pyridine-1,3-dione |
| SMILES | CC(C)(CCCO)CN1C(=O)c2ccncc2C1=O |
| InChI | InChI=1S/C14H18N2O3/c1-14(2,5-3-7-17)9-16-12(18)10-4-6-15-8-11(10)13(16)19/h4,6,8,17H,3,5,7,9H2,1-2H3 |
| InChIKey | ZIKOCLARRZGHMO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|