About N-(5-bromo-2,2-dimethylpentyl)-1-methylsulfonylmethanesulfonamide
N-(5-bromo-2,2-dimethylpentyl)-1-methylsulfonylmethanesulfonamide (PubChem CID 106146424) has the molecular formula C9H20BrNO4S2
and a molecular weight of 350.30 g/mol. Its IUPAC name is N-(5-bromo-2,2-dimethylpentyl)-1-methylsulfonylmethanesulfonamide.
Molecular Properties
| Compound Name | N-(5-bromo-2,2-dimethylpentyl)-1-methylsulfonylmethanesulfonamide |
| PubChem CID | 106146424 |
| Molecular Formula | C9H20BrNO4S2 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | N-(5-bromo-2,2-dimethylpentyl)-1-methylsulfonylmethanesulfonamide |
| SMILES | CC(C)(CCCBr)CNS(=O)(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C9H20BrNO4S2/c1-9(2,5-4-6-10)7-11-17(14,15)8-16(3,12)13/h11H,4-8H2,1-3H3 |
| InChIKey | YOUQZRLMJFZKOX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(5-bromo-2,2-dimethylpentyl)-1-methylsulfonylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-2,2-dimethylpentyl)-1-methylsulfonylmethanesulfonamide?
The IUPAC name of N-(5-bromo-2,2-dimethylpentyl)-1-methylsulfonylmethanesulfonamide (CID 106146424) is N-(5-bromo-2,2-dimethylpentyl)-1-methylsulfonylmethanesulfonamide.
What is the SMILES notation for N-(5-bromo-2,2-dimethylpentyl)-1-methylsulfonylmethanesulfonamide?
The canonical SMILES for N-(5-bromo-2,2-dimethylpentyl)-1-methylsulfonylmethanesulfonamide is CC(C)(CCCBr)CNS(=O)(=O)CS(C)(=O)=O.
What is the InChIKey of N-(5-bromo-2,2-dimethylpentyl)-1-methylsulfonylmethanesulfonamide?
The InChIKey is YOUQZRLMJFZKOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20BrNO4S2/c1-9(2,5-4-6-10)7-11-17(14,15)8-16(3,12)13/h11H,4-8H2,1-3H3.
What are the key properties of N-(5-bromo-2,2-dimethylpentyl)-1-methylsulfonylmethanesulfonamide?
N-(5-bromo-2,2-dimethylpentyl)-1-methylsulfonylmethanesulfonamide has a molecular weight of 350.30 g/mol, XLogP of 1.11, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-2,2-dimethylpentyl)-1-methylsulfonylmethanesulfonamide is sourced from PubChem (CID 106146424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).