About propan-2-yl 2-[(4-hydroxy-2,2-dimethylbutyl)amino]acetate
propan-2-yl 2-[(4-hydroxy-2,2-dimethylbutyl)amino]acetate (PubChem CID 106146656) has the molecular formula C11H23NO3
and a molecular weight of 217.31 g/mol. Its IUPAC name is propan-2-yl 2-[(4-hydroxy-2,2-dimethylbutyl)amino]acetate.
Analyze propan-2-yl 2-[(4-hydroxy-2,2-dimethylbutyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[(4-hydroxy-2,2-dimethylbutyl)amino]acetate?
The IUPAC name of propan-2-yl 2-[(4-hydroxy-2,2-dimethylbutyl)amino]acetate (CID 106146656) is propan-2-yl 2-[(4-hydroxy-2,2-dimethylbutyl)amino]acetate.
What is the SMILES notation for propan-2-yl 2-[(4-hydroxy-2,2-dimethylbutyl)amino]acetate?
The canonical SMILES for propan-2-yl 2-[(4-hydroxy-2,2-dimethylbutyl)amino]acetate is CC(C)OC(=O)CNCC(C)(C)CCO.
What is the InChIKey of propan-2-yl 2-[(4-hydroxy-2,2-dimethylbutyl)amino]acetate?
The InChIKey is DMLDDFWYDNIFKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO3/c1-9(2)15-10(14)7-12-8-11(3,4)5-6-13/h9,12-13H,5-8H2,1-4H3.
What are the key properties of propan-2-yl 2-[(4-hydroxy-2,2-dimethylbutyl)amino]acetate?
propan-2-yl 2-[(4-hydroxy-2,2-dimethylbutyl)amino]acetate has a molecular weight of 217.31 g/mol, XLogP of 0.94, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[(4-hydroxy-2,2-dimethylbutyl)amino]acetate is sourced from PubChem (CID 106146656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).