C16H26N2O2 — CID 106147368
4-[[(5-hydroxy-2,2-dimethylpentyl)amino]methyl]-3-methylbenzamide (PubChem CID 106147368) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 4-[[(5-hydroxy-2,2-dimethylpentyl)amino]methyl]-3-methylbenzamide.
| Compound Name | 4-[[(5-hydroxy-2,2-dimethylpentyl)amino]methyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 106147368 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 4-[[(5-hydroxy-2,2-dimethylpentyl)amino]methyl]-3-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)ccc1CNCC(C)(C)CCCO |
| InChI | InChI=1S/C16H26N2O2/c1-12-9-13(15(17)20)5-6-14(12)10-18-11-16(2,3)7-4-8-19/h5-6,9,18-19H,4,7-8,10-11H2,1-3H3,(H2,17,20) |
| InChIKey | WHPUEAFIMYFUPA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |