C12H27N3O2 — CID 106148529
5-amino-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-4-methylpentanamide (PubChem CID 106148529) has the molecular formula C12H27N3O2 and a molecular weight of 245.37 g/mol. Its IUPAC name is 5-amino-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-4-methylpentanamide.
| Compound Name | 5-amino-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 106148529 |
| Molecular Formula | C12H27N3O2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 5-amino-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-4-methylpentanamide |
| SMILES | CC(CN)CCC(=O)NCC(C)(O)CN(C)C |
| InChI | InChI=1S/C12H27N3O2/c1-10(7-13)5-6-11(16)14-8-12(2,17)9-15(3)4/h10,17H,5-9,13H2,1-4H3,(H,14,16) |
| InChIKey | ZNSBFBKSAPTGSW-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |