About 4-chloro-5-[(4-hydroxy-2,2-dimethylbutyl)amino]-2-prop-2-enylpyridazin-3-one
4-chloro-5-[(4-hydroxy-2,2-dimethylbutyl)amino]-2-prop-2-enylpyridazin-3-one (PubChem CID 106148935) has the molecular formula C13H20ClN3O2
and a molecular weight of 285.78 g/mol. Its IUPAC name is 4-chloro-5-[(4-hydroxy-2,2-dimethylbutyl)amino]-2-prop-2-enylpyridazin-3-one.
Molecular Properties
| Compound Name | 4-chloro-5-[(4-hydroxy-2,2-dimethylbutyl)amino]-2-prop-2-enylpyridazin-3-one |
| PubChem CID | 106148935 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 4-chloro-5-[(4-hydroxy-2,2-dimethylbutyl)amino]-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(NCC(C)(C)CCO)c(Cl)c1=O |
| InChI | InChI=1S/C13H20ClN3O2/c1-4-6-17-12(19)11(14)10(8-16-17)15-9-13(2,3)5-7-18/h4,8,15,18H,1,5-7,9H2,2-3H3 |
| InChIKey | PYVFDDCJVACRNO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5-[(4-hydroxy-2,2-dimethylbutyl)amino]-2-prop-2-enylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-[(4-hydroxy-2,2-dimethylbutyl)amino]-2-prop-2-enylpyridazin-3-one?
The IUPAC name of 4-chloro-5-[(4-hydroxy-2,2-dimethylbutyl)amino]-2-prop-2-enylpyridazin-3-one (CID 106148935) is 4-chloro-5-[(4-hydroxy-2,2-dimethylbutyl)amino]-2-prop-2-enylpyridazin-3-one.
What is the SMILES notation for 4-chloro-5-[(4-hydroxy-2,2-dimethylbutyl)amino]-2-prop-2-enylpyridazin-3-one?
The canonical SMILES for 4-chloro-5-[(4-hydroxy-2,2-dimethylbutyl)amino]-2-prop-2-enylpyridazin-3-one is C=CCn1ncc(NCC(C)(C)CCO)c(Cl)c1=O.
What is the InChIKey of 4-chloro-5-[(4-hydroxy-2,2-dimethylbutyl)amino]-2-prop-2-enylpyridazin-3-one?
The InChIKey is PYVFDDCJVACRNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20ClN3O2/c1-4-6-17-12(19)11(14)10(8-16-17)15-9-13(2,3)5-7-18/h4,8,15,18H,1,5-7,9H2,2-3H3.
What are the key properties of 4-chloro-5-[(4-hydroxy-2,2-dimethylbutyl)amino]-2-prop-2-enylpyridazin-3-one?
4-chloro-5-[(4-hydroxy-2,2-dimethylbutyl)amino]-2-prop-2-enylpyridazin-3-one has a molecular weight of 285.78 g/mol, XLogP of 1.90, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-[(4-hydroxy-2,2-dimethylbutyl)amino]-2-prop-2-enylpyridazin-3-one is sourced from PubChem (CID 106148935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).