C15H18ClNO4 — CID 10614987
3-[(3aS,4S,6S,6aS)-6-(chloromethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]benzamide (PubChem CID 10614987) has the molecular formula C15H18ClNO4 and a molecular weight of 311.77 g/mol. Its IUPAC name is 3-[(3aS,4S,6S,6aS)-6-(chloromethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]benzamide.
| Compound Name | 3-[(3aS,4S,6S,6aS)-6-(chloromethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]benzamide |
|---|---|
| PubChem CID | 10614987 |
| Molecular Formula | C15H18ClNO4 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 3-[(3aS,4S,6S,6aS)-6-(chloromethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]benzamide |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CCl)O[C@H]2c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C15H18ClNO4/c1-15(2)20-12-10(7-16)19-11(13(12)21-15)8-4-3-5-9(6-8)14(17)18/h3-6,10-13H,7H2,1-2H3,(H2,17,18)/t10-,11+,12-,13+/m1/s1 |
| InChIKey | QLMRTAJSCBTGRZ-XQHKEYJVSA-N |
| XLogP | 1.98 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|