About [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] butanoate
[(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] butanoate (PubChem CID 10615048) has the molecular formula C17H32O3Si
and a molecular weight of 312.53 g/mol. Its IUPAC name is [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] butanoate.
Molecular Properties
| Compound Name | [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] butanoate |
| PubChem CID | 10615048 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1CC=C[C@@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O3Si/c1-7-9-16(18)20-15-11-8-10-14(15)12-13-19-21(5,6)17(2,3)4/h8,10,14-15H,7,9,11-13H2,1-6H3/t14-,15-/m1/s1 |
| InChIKey | HCHREAYVFLYHNH-HUUCEWRRSA-N |
| XLogP | 4.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] butanoate?
The IUPAC name of [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] butanoate (CID 10615048) is [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] butanoate.
What is the SMILES notation for [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] butanoate?
The canonical SMILES for [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] butanoate is CCCC(=O)O[C@@H]1CC=C[C@@H]1CCO[Si](C)(C)C(C)(C)C.
What is the InChIKey of [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] butanoate?
The InChIKey is HCHREAYVFLYHNH-HUUCEWRRSA-N. The full InChI is InChI=1S/C17H32O3Si/c1-7-9-16(18)20-15-11-8-10-14(15)12-13-19-21(5,6)17(2,3)4/h8,10,14-15H,7,9,11-13H2,1-6H3/t14-,15-/m1/s1.
What are the key properties of [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] butanoate?
[(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] butanoate has a molecular weight of 312.53 g/mol, XLogP of 4.69, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] butanoate is sourced from PubChem (CID 10615048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).