C12H15ClN4O3 — CID 106150503
1-(6-chloro-4-nitro-2-pyridinyl)-N,3-dimethylpyrrolidine-3-carboxamide (PubChem CID 106150503) has the molecular formula C12H15ClN4O3 and a molecular weight of 298.73 g/mol. Its IUPAC name is 1-(6-chloro-4-nitro-2-pyridinyl)-N,3-dimethylpyrrolidine-3-carboxamide.
| Compound Name | 1-(6-chloro-4-nitro-2-pyridinyl)-N,3-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 106150503 |
| Molecular Formula | C12H15ClN4O3 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1-(6-chloro-4-nitro-2-pyridinyl)-N,3-dimethylpyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1(C)CCN(c2cc([N+](=O)[O-])cc(Cl)n2)C1 |
| InChI | InChI=1S/C12H15ClN4O3/c1-12(11(18)14-2)3-4-16(7-12)10-6-8(17(19)20)5-9(13)15-10/h5-6H,3-4,7H2,1-2H3,(H,14,18) |
| InChIKey | MKZMGXMMUAZXDT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|