C13H16N4O — CID 106150514
1-(6-cyano-3-pyridinyl)-N,3-dimethylpyrrolidine-3-carboxamide (PubChem CID 106150514) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 1-(6-cyano-3-pyridinyl)-N,3-dimethylpyrrolidine-3-carboxamide.
| Compound Name | 1-(6-cyano-3-pyridinyl)-N,3-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 106150514 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1-(6-cyano-3-pyridinyl)-N,3-dimethylpyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1(C)CCN(c2ccc(C#N)nc2)C1 |
| InChI | InChI=1S/C13H16N4O/c1-13(12(18)15-2)5-6-17(9-13)11-4-3-10(7-14)16-8-11/h3-4,8H,5-6,9H2,1-2H3,(H,15,18) |
| InChIKey | VTMCOEGSQKTCOT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |