C10H18ClN3O3S — CID 106150868
4-chloro-N-(5-hydroxypentyl)-N,1-dimethylpyrazole-5-sulfonamide (PubChem CID 106150868) has the molecular formula C10H18ClN3O3S and a molecular weight of 295.79 g/mol. Its IUPAC name is 4-chloro-N-(5-hydroxypentyl)-N,1-dimethylpyrazole-5-sulfonamide.
| Compound Name | 4-chloro-N-(5-hydroxypentyl)-N,1-dimethylpyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106150868 |
| Molecular Formula | C10H18ClN3O3S |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 4-chloro-N-(5-hydroxypentyl)-N,1-dimethylpyrazole-5-sulfonamide |
| SMILES | CN(CCCCCO)S(=O)(=O)c1c(Cl)cnn1C |
| InChI | InChI=1S/C10H18ClN3O3S/c1-13(6-4-3-5-7-15)18(16,17)10-9(11)8-12-14(10)2/h8,15H,3-7H2,1-2H3 |
| InChIKey | MIKLLBFCBGHLMF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|