C13H12F7N — CID 10615229
3,3,4,4,5,5,5-heptafluoro-N-[(1S)-1-phenylethyl]pentan-2-imine (PubChem CID 10615229) has the molecular formula C13H12F7N and a molecular weight of 315.23 g/mol. Its IUPAC name is 3,3,4,4,5,5,5-heptafluoro-N-[(1S)-1-phenylethyl]pentan-2-imine.
| Compound Name | 3,3,4,4,5,5,5-heptafluoro-N-[(1S)-1-phenylethyl]pentan-2-imine |
|---|---|
| PubChem CID | 10615229 |
| Molecular Formula | C13H12F7N |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 3,3,4,4,5,5,5-heptafluoro-N-[(1S)-1-phenylethyl]pentan-2-imine |
| SMILES | C/C(=N\[C@@H](C)c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H12F7N/c1-8(10-6-4-3-5-7-10)21-9(2)11(14,15)12(16,17)13(18,19)20/h3-8H,1-2H3/b21-9+/t8-/m0/s1 |
| InChIKey | ARJARAWTMRNLJE-HKKPXOMISA-N |
| XLogP | 5.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|