C12H22ClN3O — CID 106152849
4-chloro-1-methoxy-N-[(1-propan-2-ylpyrazol-3-yl)methyl]butan-2-amine (PubChem CID 106152849) has the molecular formula C12H22ClN3O and a molecular weight of 259.78 g/mol. Its IUPAC name is 4-chloro-1-methoxy-N-[(1-propan-2-ylpyrazol-3-yl)methyl]butan-2-amine.
| Compound Name | 4-chloro-1-methoxy-N-[(1-propan-2-ylpyrazol-3-yl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 106152849 |
| Molecular Formula | C12H22ClN3O |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 4-chloro-1-methoxy-N-[(1-propan-2-ylpyrazol-3-yl)methyl]butan-2-amine |
| SMILES | COCC(CCCl)NCc1ccn(C(C)C)n1 |
| InChI | InChI=1S/C12H22ClN3O/c1-10(2)16-7-5-11(15-16)8-14-12(4-6-13)9-17-3/h5,7,10,12,14H,4,6,8-9H2,1-3H3 |
| InChIKey | SXJFVNZMQNNGGG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|