C14H24N2O3S — CID 106152997
3-amino-N-(5-hydroxy-4-methylpentyl)-4,5-dimethylbenzenesulfonamide (PubChem CID 106152997) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is 3-amino-N-(5-hydroxy-4-methylpentyl)-4,5-dimethylbenzenesulfonamide.
| Compound Name | 3-amino-N-(5-hydroxy-4-methylpentyl)-4,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106152997 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 3-amino-N-(5-hydroxy-4-methylpentyl)-4,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCC(C)CO)cc(N)c1C |
| InChI | InChI=1S/C14H24N2O3S/c1-10(9-17)5-4-6-16-20(18,19)13-7-11(2)12(3)14(15)8-13/h7-8,10,16-17H,4-6,9,15H2,1-3H3 |
| InChIKey | IYMMQKWZXXRLAH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|