About 6-bromo-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine
6-bromo-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine (PubChem CID 10615399) has the molecular formula C15H13BrN2O
and a molecular weight of 317.19 g/mol. Its IUPAC name is 6-bromo-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine.
Molecular Properties
| Compound Name | 6-bromo-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine |
| PubChem CID | 10615399 |
| Molecular Formula | C15H13BrN2O |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 6-bromo-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine |
| SMILES | CC1(C)N=C(c2ccccn2)c2cc(Br)ccc2O1 |
| InChI | InChI=1S/C15H13BrN2O/c1-15(2)18-14(12-5-3-4-8-17-12)11-9-10(16)6-7-13(11)19-15/h3-9H,1-2H3 |
| InChIKey | NUMQSHGLOZYWCJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine?
The IUPAC name of 6-bromo-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine (CID 10615399) is 6-bromo-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine.
What is the SMILES notation for 6-bromo-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine?
The canonical SMILES for 6-bromo-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine is CC1(C)N=C(c2ccccn2)c2cc(Br)ccc2O1.
What is the InChIKey of 6-bromo-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine?
The InChIKey is NUMQSHGLOZYWCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrN2O/c1-15(2)18-14(12-5-3-4-8-17-12)11-9-10(16)6-7-13(11)19-15/h3-9H,1-2H3.
What are the key properties of 6-bromo-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine?
6-bromo-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine has a molecular weight of 317.19 g/mol, XLogP of 3.81, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,2-dimethyl-4-pyridin-2-yl-1,3-benzoxazine is sourced from PubChem (CID 10615399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).