C9H21N3O2S — CID 106154211
N'-(cyclopropylsulfamoyl)-2-methylpentane-1,5-diamine (PubChem CID 106154211) has the molecular formula C9H21N3O2S and a molecular weight of 235.35 g/mol. Its IUPAC name is N'-(cyclopropylsulfamoyl)-2-methylpentane-1,5-diamine.
| Compound Name | N'-(cyclopropylsulfamoyl)-2-methylpentane-1,5-diamine |
|---|---|
| PubChem CID | 106154211 |
| Molecular Formula | C9H21N3O2S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N'-(cyclopropylsulfamoyl)-2-methylpentane-1,5-diamine |
| SMILES | CC(CN)CCCNS(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C9H21N3O2S/c1-8(7-10)3-2-6-11-15(13,14)12-9-4-5-9/h8-9,11-12H,2-7,10H2,1H3 |
| InChIKey | DQQKRTGGTZHEOU-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|