C12H17N5O — CID 106154714
3-N-(1,2,4-benzotriazin-3-yl)-4-methoxybutane-1,3-diamine (PubChem CID 106154714) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 3-N-(1,2,4-benzotriazin-3-yl)-4-methoxybutane-1,3-diamine.
| Compound Name | 3-N-(1,2,4-benzotriazin-3-yl)-4-methoxybutane-1,3-diamine |
|---|---|
| PubChem CID | 106154714 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 3-N-(1,2,4-benzotriazin-3-yl)-4-methoxybutane-1,3-diamine |
| SMILES | COCC(CCN)Nc1nnc2ccccc2n1 |
| InChI | InChI=1S/C12H17N5O/c1-18-8-9(6-7-13)14-12-15-10-4-2-3-5-11(10)16-17-12/h2-5,9H,6-8,13H2,1H3,(H,14,15,17) |
| InChIKey | JFTOWBIGIUTODA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |