C9H15F3N4S — CID 106155171
2-methyl-N'-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pentane-1,5-diamine (PubChem CID 106155171) has the molecular formula C9H15F3N4S and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-methyl-N'-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pentane-1,5-diamine.
| Compound Name | 2-methyl-N'-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 106155171 |
| Molecular Formula | C9H15F3N4S |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-methyl-N'-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pentane-1,5-diamine |
| SMILES | CC(CN)CCCNc1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C9H15F3N4S/c1-6(5-13)3-2-4-14-8-15-7(16-17-8)9(10,11)12/h6H,2-5,13H2,1H3,(H,14,15,16) |
| InChIKey | VDXPIYWAGKUBCC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|