C14H16ClNO3 — CID 106155716
N-(4-chloro-1-methoxybutan-2-yl)-1-benzofuran-3-carboxamide (PubChem CID 106155716) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is N-(4-chloro-1-methoxybutan-2-yl)-1-benzofuran-3-carboxamide.
| Compound Name | N-(4-chloro-1-methoxybutan-2-yl)-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 106155716 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-(4-chloro-1-methoxybutan-2-yl)-1-benzofuran-3-carboxamide |
| SMILES | COCC(CCCl)NC(=O)c1coc2ccccc12 |
| InChI | InChI=1S/C14H16ClNO3/c1-18-8-10(6-7-15)16-14(17)12-9-19-13-5-3-2-4-11(12)13/h2-5,9-10H,6-8H2,1H3,(H,16,17) |
| InChIKey | KJPNZGRGRWWNKD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|