C17H21NO5 — CID 10615578
methyl (7S,9aS)-7-hydroxy-1-(2-methoxy-2-oxoethyl)-2,3,7,8,9,9a-hexahydrobenzo[de]quinoline-5-carboxylate (PubChem CID 10615578) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is methyl (7S,9aS)-7-hydroxy-1-(2-methoxy-2-oxoethyl)-2,3,7,8,9,9a-hexahydrobenzo[de]quinoline-5-carboxylate.
| Compound Name | methyl (7S,9aS)-7-hydroxy-1-(2-methoxy-2-oxoethyl)-2,3,7,8,9,9a-hexahydrobenzo[de]quinoline-5-carboxylate |
|---|---|
| PubChem CID | 10615578 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | methyl (7S,9aS)-7-hydroxy-1-(2-methoxy-2-oxoethyl)-2,3,7,8,9,9a-hexahydrobenzo[de]quinoline-5-carboxylate |
| SMILES | COC(=O)CN1CCc2cc(C(=O)OC)cc3c2[C@@H]1CC[C@@H]3O |
| InChI | InChI=1S/C17H21NO5/c1-22-15(20)9-18-6-5-10-7-11(17(21)23-2)8-12-14(19)4-3-13(18)16(10)12/h7-8,13-14,19H,3-6,9H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | XLYJSNAXBARFMI-KBPBESRZSA-N |
| XLogP | 1.37 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |