C9H17NO2S — CID 106156261
N-(4-hydroxy-3-methylsulfanylbutan-2-yl)but-3-enamide (PubChem CID 106156261) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylsulfanylbutan-2-yl)but-3-enamide.
| Compound Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)but-3-enamide |
|---|---|
| PubChem CID | 106156261 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)but-3-enamide |
| SMILES | C=CCC(=O)NC(C)C(CO)SC |
| InChI | InChI=1S/C9H17NO2S/c1-4-5-9(12)10-7(2)8(6-11)13-3/h4,7-8,11H,1,5-6H2,2-3H3,(H,10,12) |
| InChIKey | BTAQZOINVBHIQS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|