C19H28O4 — CID 10615665
(3aR,4aR,8bR)-8b-hydroxy-3a-methyl-1,2-di(propan-2-yloxy)-4a,5,6,7-tetrahydro-4H-cyclopenta[a]inden-3-one (PubChem CID 10615665) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (3aR,4aR,8bR)-8b-hydroxy-3a-methyl-1,2-di(propan-2-yloxy)-4a,5,6,7-tetrahydro-4H-cyclopenta[a]inden-3-one.
| Compound Name | (3aR,4aR,8bR)-8b-hydroxy-3a-methyl-1,2-di(propan-2-yloxy)-4a,5,6,7-tetrahydro-4H-cyclopenta[a]inden-3-one |
|---|---|
| PubChem CID | 10615665 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (3aR,4aR,8bR)-8b-hydroxy-3a-methyl-1,2-di(propan-2-yloxy)-4a,5,6,7-tetrahydro-4H-cyclopenta[a]inden-3-one |
| SMILES | CC(C)OC1=C(OC(C)C)[C@@]2(O)C3=CCCC[C@@H]3C[C@@]2(C)C1=O |
| InChI | InChI=1S/C19H28O4/c1-11(2)22-15-16(20)18(5)10-13-8-6-7-9-14(13)19(18,21)17(15)23-12(3)4/h9,11-13,21H,6-8,10H2,1-5H3/t13-,18+,19+/m1/s1 |
| InChIKey | GBROHCSRKSMIRY-VMDGZTHMSA-N |
| XLogP | 3.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|