C12H21NO3 — CID 106156673
3-[1-(furan-2-yl)propylamino]-4-methoxybutan-1-ol (PubChem CID 106156673) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 3-[1-(furan-2-yl)propylamino]-4-methoxybutan-1-ol.
| Compound Name | 3-[1-(furan-2-yl)propylamino]-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 106156673 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 3-[1-(furan-2-yl)propylamino]-4-methoxybutan-1-ol |
| SMILES | CCC(NC(CCO)COC)c1ccco1 |
| InChI | InChI=1S/C12H21NO3/c1-3-11(12-5-4-8-16-12)13-10(6-7-14)9-15-2/h4-5,8,10-11,13-14H,3,6-7,9H2,1-2H3 |
| InChIKey | TXYNDZHROGZHGO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |