C16H24ClNO2 — CID 106157174
N-(5-chloro-4-methylpentyl)-3-propoxybenzamide (PubChem CID 106157174) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is N-(5-chloro-4-methylpentyl)-3-propoxybenzamide.
| Compound Name | N-(5-chloro-4-methylpentyl)-3-propoxybenzamide |
|---|---|
| PubChem CID | 106157174 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-(5-chloro-4-methylpentyl)-3-propoxybenzamide |
| SMILES | CCCOc1cccc(C(=O)NCCCC(C)CCl)c1 |
| InChI | InChI=1S/C16H24ClNO2/c1-3-10-20-15-8-4-7-14(11-15)16(19)18-9-5-6-13(2)12-17/h4,7-8,11,13H,3,5-6,9-10,12H2,1-2H3,(H,18,19) |
| InChIKey | DSZPZNRPEVTPIO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|