C13H19ClFNO3S — CID 106158220
N-(4-chloro-1-methoxybutan-2-yl)-4-fluoro-2,6-dimethylbenzenesulfonamide (PubChem CID 106158220) has the molecular formula C13H19ClFNO3S and a molecular weight of 323.82 g/mol. Its IUPAC name is N-(4-chloro-1-methoxybutan-2-yl)-4-fluoro-2,6-dimethylbenzenesulfonamide.
| Compound Name | N-(4-chloro-1-methoxybutan-2-yl)-4-fluoro-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106158220 |
| Molecular Formula | C13H19ClFNO3S |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | N-(4-chloro-1-methoxybutan-2-yl)-4-fluoro-2,6-dimethylbenzenesulfonamide |
| SMILES | COCC(CCCl)NS(=O)(=O)c1c(C)cc(F)cc1C |
| InChI | InChI=1S/C13H19ClFNO3S/c1-9-6-11(15)7-10(2)13(9)20(17,18)16-12(4-5-14)8-19-3/h6-7,12,16H,4-5,8H2,1-3H3 |
| InChIKey | WOZJRCUWDFTFBC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|