C9H14F3N3OS — CID 106158371
2-methyl-5-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]pentan-1-ol (PubChem CID 106158371) has the molecular formula C9H14F3N3OS and a molecular weight of 269.29 g/mol. Its IUPAC name is 2-methyl-5-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]pentan-1-ol.
| Compound Name | 2-methyl-5-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 106158371 |
| Molecular Formula | C9H14F3N3OS |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-methyl-5-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]pentan-1-ol |
| SMILES | CC(CO)CCCNc1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C9H14F3N3OS/c1-6(5-16)3-2-4-13-8-14-7(15-17-8)9(10,11)12/h6,16H,2-5H2,1H3,(H,13,14,15) |
| InChIKey | ZRCMXAYMDOXCSU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|