C7H14BrF2NO2S — CID 106158712
N-(5-bromo-4-methylpentyl)-1,1-difluoromethanesulfonamide (PubChem CID 106158712) has the molecular formula C7H14BrF2NO2S and a molecular weight of 294.16 g/mol. Its IUPAC name is N-(5-bromo-4-methylpentyl)-1,1-difluoromethanesulfonamide.
| Compound Name | N-(5-bromo-4-methylpentyl)-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 106158712 |
| Molecular Formula | C7H14BrF2NO2S |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | N-(5-bromo-4-methylpentyl)-1,1-difluoromethanesulfonamide |
| SMILES | CC(CBr)CCCNS(=O)(=O)C(F)F |
| InChI | InChI=1S/C7H14BrF2NO2S/c1-6(5-8)3-2-4-11-14(12,13)7(9)10/h6-7,11H,2-5H2,1H3 |
| InChIKey | UBIBQMUIYPLKOT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|