About 3-(1,1-difluoropropan-2-ylamino)-2-methylsulfanylbutan-1-ol
3-(1,1-difluoropropan-2-ylamino)-2-methylsulfanylbutan-1-ol (PubChem CID 106158820) has the molecular formula C8H17F2NOS
and a molecular weight of 213.29 g/mol. Its IUPAC name is 3-(1,1-difluoropropan-2-ylamino)-2-methylsulfanylbutan-1-ol.
Molecular Properties
| Compound Name | 3-(1,1-difluoropropan-2-ylamino)-2-methylsulfanylbutan-1-ol |
| PubChem CID | 106158820 |
| Molecular Formula | C8H17F2NOS |
| Molecular Weight | 213.29 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 3-(1,1-difluoropropan-2-ylamino)-2-methylsulfanylbutan-1-ol |
| SMILES | CSC(CO)C(C)NC(C)C(F)F |
| InChI | InChI=1S/C8H17F2NOS/c1-5(7(4-12)13-3)11-6(2)8(9)10/h5-8,11-12H,4H2,1-3H3 |
| InChIKey | HVGNTURIWUXHHG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,1-difluoropropan-2-ylamino)-2-methylsulfanylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-difluoropropan-2-ylamino)-2-methylsulfanylbutan-1-ol?
The IUPAC name of 3-(1,1-difluoropropan-2-ylamino)-2-methylsulfanylbutan-1-ol (CID 106158820) is 3-(1,1-difluoropropan-2-ylamino)-2-methylsulfanylbutan-1-ol.
What is the SMILES notation for 3-(1,1-difluoropropan-2-ylamino)-2-methylsulfanylbutan-1-ol?
The canonical SMILES for 3-(1,1-difluoropropan-2-ylamino)-2-methylsulfanylbutan-1-ol is CSC(CO)C(C)NC(C)C(F)F.
What is the InChIKey of 3-(1,1-difluoropropan-2-ylamino)-2-methylsulfanylbutan-1-ol?
The InChIKey is HVGNTURIWUXHHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17F2NOS/c1-5(7(4-12)13-3)11-6(2)8(9)10/h5-8,11-12H,4H2,1-3H3.
What are the key properties of 3-(1,1-difluoropropan-2-ylamino)-2-methylsulfanylbutan-1-ol?
3-(1,1-difluoropropan-2-ylamino)-2-methylsulfanylbutan-1-ol has a molecular weight of 213.29 g/mol, XLogP of 1.34, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-difluoropropan-2-ylamino)-2-methylsulfanylbutan-1-ol is sourced from PubChem (CID 106158820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).