C12H20N2O3S2 — CID 106158902
4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-N-methylbenzenesulfonamide (PubChem CID 106158902) has the molecular formula C12H20N2O3S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-N-methylbenzenesulfonamide.
| Compound Name | 4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106158902 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(C)C(CO)SC)cc1 |
| InChI | InChI=1S/C12H20N2O3S2/c1-9(12(8-15)18-3)14-10-4-6-11(7-5-10)19(16,17)13-2/h4-7,9,12-15H,8H2,1-3H3 |
| InChIKey | MHKKTFWNTDWXEA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |