C17H22ClNO3 — CID 10615927
(2S,7aR)-7a-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxymethyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one (PubChem CID 10615927) has the molecular formula C17H22ClNO3 and a molecular weight of 323.82 g/mol. Its IUPAC name is (2S,7aR)-7a-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxymethyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one.
| Compound Name | (2S,7aR)-7a-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxymethyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 10615927 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (2S,7aR)-7a-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxymethyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one |
| SMILES | CC(C)(C)OC[C@@H]1CN2C(=O)CC[C@]2(c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C17H22ClNO3/c1-16(2,3)21-11-14-10-19-15(20)8-9-17(19,22-14)12-4-6-13(18)7-5-12/h4-7,14H,8-11H2,1-3H3/t14-,17+/m0/s1 |
| InChIKey | NHCFZTOABRFTOW-WMLDXEAASA-N |
| XLogP | 3.33 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |