About 2-methylsulfanyl-3-(1,2,4-triazol-4-yl)butan-1-ol
2-methylsulfanyl-3-(1,2,4-triazol-4-yl)butan-1-ol (PubChem CID 106159479) has the molecular formula C7H13N3OS
and a molecular weight of 187.27 g/mol. Its IUPAC name is 2-methylsulfanyl-3-(1,2,4-triazol-4-yl)butan-1-ol.
Molecular Properties
| Compound Name | 2-methylsulfanyl-3-(1,2,4-triazol-4-yl)butan-1-ol |
| PubChem CID | 106159479 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-methylsulfanyl-3-(1,2,4-triazol-4-yl)butan-1-ol |
| SMILES | CSC(CO)C(C)n1cnnc1 |
| InChI | InChI=1S/C7H13N3OS/c1-6(7(3-11)12-2)10-4-8-9-5-10/h4-7,11H,3H2,1-2H3 |
| InChIKey | IWHSCMFFNRAZGK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylsulfanyl-3-(1,2,4-triazol-4-yl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-3-(1,2,4-triazol-4-yl)butan-1-ol?
The IUPAC name of 2-methylsulfanyl-3-(1,2,4-triazol-4-yl)butan-1-ol (CID 106159479) is 2-methylsulfanyl-3-(1,2,4-triazol-4-yl)butan-1-ol.
What is the SMILES notation for 2-methylsulfanyl-3-(1,2,4-triazol-4-yl)butan-1-ol?
The canonical SMILES for 2-methylsulfanyl-3-(1,2,4-triazol-4-yl)butan-1-ol is CSC(CO)C(C)n1cnnc1.
What is the InChIKey of 2-methylsulfanyl-3-(1,2,4-triazol-4-yl)butan-1-ol?
The InChIKey is IWHSCMFFNRAZGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3OS/c1-6(7(3-11)12-2)10-4-8-9-5-10/h4-7,11H,3H2,1-2H3.
What are the key properties of 2-methylsulfanyl-3-(1,2,4-triazol-4-yl)butan-1-ol?
2-methylsulfanyl-3-(1,2,4-triazol-4-yl)butan-1-ol has a molecular weight of 187.27 g/mol, XLogP of 0.56, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-3-(1,2,4-triazol-4-yl)butan-1-ol is sourced from PubChem (CID 106159479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).