C13H22N2O2 — CID 106159969
1-[2-[(5-hydroxy-4-methylpentyl)amino]ethyl]pyridin-2-one (PubChem CID 106159969) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-[2-[(5-hydroxy-4-methylpentyl)amino]ethyl]pyridin-2-one.
| Compound Name | 1-[2-[(5-hydroxy-4-methylpentyl)amino]ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 106159969 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-[2-[(5-hydroxy-4-methylpentyl)amino]ethyl]pyridin-2-one |
| SMILES | CC(CO)CCCNCCn1ccccc1=O |
| InChI | InChI=1S/C13H22N2O2/c1-12(11-16)5-4-7-14-8-10-15-9-3-2-6-13(15)17/h2-3,6,9,12,14,16H,4-5,7-8,10-11H2,1H3 |
| InChIKey | WEDCRNRJNLLEGV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|