C16H15N5O3 — CID 10616021
1,3,12-trimethyl-11H-purino[8,7-c][2,4]benzodiazepine-2,4,6-trione (PubChem CID 10616021) has the molecular formula C16H15N5O3 and a molecular weight of 325.33 g/mol. Its IUPAC name is 1,3,12-trimethyl-11H-purino[8,7-c][2,4]benzodiazepine-2,4,6-trione.
| Compound Name | 1,3,12-trimethyl-11H-purino[8,7-c][2,4]benzodiazepine-2,4,6-trione |
|---|---|
| PubChem CID | 10616021 |
| Molecular Formula | C16H15N5O3 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 1,3,12-trimethyl-11H-purino[8,7-c][2,4]benzodiazepine-2,4,6-trione |
| SMILES | CN1Cc2ccccc2C(=O)n2c1nc1c2c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C16H15N5O3/c1-18-8-9-6-4-5-7-10(9)13(22)21-11-12(17-15(18)21)19(2)16(24)20(3)14(11)23/h4-7H,8H2,1-3H3 |
| InChIKey | CRIYIDOUAYTIQY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 82.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |