About 2-methylsulfanyl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol
2-methylsulfanyl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol (PubChem CID 106160514) has the molecular formula C8H16F3NO2S
and a molecular weight of 247.28 g/mol. Its IUPAC name is 2-methylsulfanyl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol.
Molecular Properties
| Compound Name | 2-methylsulfanyl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol |
| PubChem CID | 106160514 |
| Molecular Formula | C8H16F3NO2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-methylsulfanyl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol |
| SMILES | CSC(CO)C(C)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C8H16F3NO2S/c1-5(6(4-13)15-2)12-3-7(14)8(9,10)11/h5-7,12-14H,3-4H2,1-2H3 |
| InChIKey | MGSORWHDOSLFGX-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylsulfanyl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol?
The IUPAC name of 2-methylsulfanyl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol (CID 106160514) is 2-methylsulfanyl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol.
What is the SMILES notation for 2-methylsulfanyl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol?
The canonical SMILES for 2-methylsulfanyl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol is CSC(CO)C(C)NCC(O)C(F)(F)F.
What is the InChIKey of 2-methylsulfanyl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol?
The InChIKey is MGSORWHDOSLFGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3NO2S/c1-5(6(4-13)15-2)12-3-7(14)8(9,10)11/h5-7,12-14H,3-4H2,1-2H3.
What are the key properties of 2-methylsulfanyl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol?
2-methylsulfanyl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol has a molecular weight of 247.28 g/mol, XLogP of 0.61, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol is sourced from PubChem (CID 106160514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).