C16H20ClNO4 — CID 10616075
(4R)-3-benzyl-4-[(4R,5S)-5-(chloromethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,3-oxazolidin-2-one (PubChem CID 10616075) has the molecular formula C16H20ClNO4 and a molecular weight of 325.79 g/mol. Its IUPAC name is (4R)-3-benzyl-4-[(4R,5S)-5-(chloromethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-benzyl-4-[(4R,5S)-5-(chloromethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10616075 |
| Molecular Formula | C16H20ClNO4 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (4R)-3-benzyl-4-[(4R,5S)-5-(chloromethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,3-oxazolidin-2-one |
| SMILES | CC1(C)O[C@H]([C@H]2COC(=O)N2Cc2ccccc2)[C@@H](CCl)O1 |
| InChI | InChI=1S/C16H20ClNO4/c1-16(2)21-13(8-17)14(22-16)12-10-20-15(19)18(12)9-11-6-4-3-5-7-11/h3-7,12-14H,8-10H2,1-2H3/t12-,13-,14-/m1/s1 |
| InChIKey | PNKAZTUFZCQLEV-MGPQQGTHSA-N |
| XLogP | 2.77 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|