About 3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylamino]-2-methylsulfanylbutan-1-ol
3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylamino]-2-methylsulfanylbutan-1-ol (PubChem CID 106160760) has the molecular formula C12H24N4OS
and a molecular weight of 272.42 g/mol. Its IUPAC name is 3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylamino]-2-methylsulfanylbutan-1-ol.
Molecular Properties
| Compound Name | 3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylamino]-2-methylsulfanylbutan-1-ol |
| PubChem CID | 106160760 |
| Molecular Formula | C12H24N4OS |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylamino]-2-methylsulfanylbutan-1-ol |
| SMILES | CSC(CO)C(C)NCc1ncnn1CC(C)C |
| InChI | InChI=1S/C12H24N4OS/c1-9(2)6-16-12(14-8-15-16)5-13-10(3)11(7-17)18-4/h8-11,13,17H,5-7H2,1-4H3 |
| InChIKey | MYMQLHCGYPGZRS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylamino]-2-methylsulfanylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylamino]-2-methylsulfanylbutan-1-ol?
The IUPAC name of 3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylamino]-2-methylsulfanylbutan-1-ol (CID 106160760) is 3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylamino]-2-methylsulfanylbutan-1-ol.
What is the SMILES notation for 3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylamino]-2-methylsulfanylbutan-1-ol?
The canonical SMILES for 3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylamino]-2-methylsulfanylbutan-1-ol is CSC(CO)C(C)NCc1ncnn1CC(C)C.
What is the InChIKey of 3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylamino]-2-methylsulfanylbutan-1-ol?
The InChIKey is MYMQLHCGYPGZRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N4OS/c1-9(2)6-16-12(14-8-15-16)5-13-10(3)11(7-17)18-4/h8-11,13,17H,5-7H2,1-4H3.
What are the key properties of 3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylamino]-2-methylsulfanylbutan-1-ol?
3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylamino]-2-methylsulfanylbutan-1-ol has a molecular weight of 272.42 g/mol, XLogP of 1.14, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylamino]-2-methylsulfanylbutan-1-ol is sourced from PubChem (CID 106160760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).