C11H15FN2O3S — CID 106161995
3-fluoro-2-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]pyridine-4-carboxylic acid (PubChem CID 106161995) has the molecular formula C11H15FN2O3S and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-fluoro-2-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]pyridine-4-carboxylic acid.
| Compound Name | 3-fluoro-2-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 106161995 |
| Molecular Formula | C11H15FN2O3S |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 3-fluoro-2-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]pyridine-4-carboxylic acid |
| SMILES | CSC(CO)C(C)Nc1nccc(C(=O)O)c1F |
| InChI | InChI=1S/C11H15FN2O3S/c1-6(8(5-15)18-2)14-10-9(12)7(11(16)17)3-4-13-10/h3-4,6,8,15H,5H2,1-2H3,(H,13,14)(H,16,17) |
| InChIKey | FWIAJVONMOSEOB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |